|
CAS#: 85098-69-7 Product: Dimethyl 3,3'-{[2-(4-methoxyphenyl)ethyl]imino}dipropanoate No suppilers available for the product. |
| Name | Dimethyl 3,3'-{[2-(4-methoxyphenyl)ethyl]imino}dipropanoate |
|---|---|
| Synonyms | methyl N- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.38 |
| CAS Registry Number | 85098-69-7 |
| EINECS | 285-420-4 |
| SMILES | COc1ccc(CCN(CCC(=O)OC)CCC(=O)OC)cc1 |
| InChI | 1S/C17H25NO5/c1-21-15-6-4-14(5-7-15)8-11-18(12-9-16(19)22-2)13-10-17(20)23-3/h4-7H,8-13H2,1-3H3 |
| InChIKey | JUYUUZVXPTVXKA-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.19°C at 760 mmHg (Cal.) |
| Flash point | 208.528°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 3,3'-{[2-(4-methoxyphenyl)ethyl]imino}dipropanoate |