|
CAS#: 85117-86-8 Product: 3-Bromo-2,4,6-Trichlorophenol No suppilers available for the product. |
| Name | 3-Bromo-2,4,6-Trichlorophenol |
|---|---|
| Synonyms | 3-Bromo-2,4,6-Trichloro-Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C6H2BrCl3O |
| Molecular Weight | 276.34 |
| CAS Registry Number | 85117-86-8 |
| EINECS | 285-636-9 |
| SMILES | C1=C(Cl)C(=C(Cl)C(=C1Cl)Br)O |
| InChI | 1S/C6H2BrCl3O/c7-4-2(8)1-3(9)6(11)5(4)10/h1,11H |
| InChIKey | WCSDJPCZARJMHN-UHFFFAOYSA-N |
| Density | 1.975g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.609°C at 760 mmHg (Cal.) |
| Flash point | 130.765°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-2,4,6-Trichlorophenol |