Online Database of Chemicals from Around the World
|
CAS#: 85117-73-3 Product: Methyl 3,5-Dichloro-2,4-Dihydroxy-6-Methylcyclohexa-2,4-Diene-1-Carboxylate No suppilers available for the product. |
| Name | Methyl 3,5-Dichloro-2,4-Dihydroxy-6-Methylcyclohexa-2,4-Diene-1-Carboxylate |
|---|---|
| Synonyms | Methyl 3,5-Dichloro-2,4-Dihydroxy-6-Methyl-Cyclohexa-2,4-Diene-1-Carboxylate; 3,5-Dichloro-2,4-Dihydroxy-6-Methyl-1-Cyclohexa-2,4-Dienecarboxylic Acid Methyl Ester; 3,5-Dichloro-2,4-Dihydroxy-6-Methyl-Cyclohexa-2,4-Diene-1-Carboxylic Acid Methyl Ester |
| Molecular Structure |  |
| Molecular Formula | C9H10Cl2O4 |
| Molecular Weight | 253.08 |
| CAS Registry Number | 85117-73-3 |
| EINECS | 285-622-2 |
| SMILES | COC(=O)C1C(=C(Cl)C(=C(Cl)C1C)O)O |
| InChI | 1S/C9H10Cl2O4/c1-3-4(9(14)15-2)7(12)6(11)8(13)5(3)10/h3-4,12-13H,1-2H3 |
| InChIKey | BRUORQOYZCQXEW-UHFFFAOYSA-N |
| Density | 1.509g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.335°C at 760 mmHg (Cal.) |
| Flash point | 124.552°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3,5-Dichloro-2,4-Dihydroxy-6-Methylcyclohexa-2,4-Diene-1-Carboxylate |