|
CAS#: 85117-89-1 Product: 4-Cyclohexylmorpholinium Chloride No suppilers available for the product. |
| Name | 4-Cyclohexylmorpholinium Chloride |
|---|---|
| Synonyms | Nsc7980; 4-Cyclohexylmorpholinium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H20ClNO |
| Molecular Weight | 205.73 |
| CAS Registry Number | 85117-89-1 |
| EINECS | 285-640-0 |
| SMILES | [H+].C2N(C1CCCCC1)CCOC2.[Cl-] |
| InChI | 1S/C10H19NO.ClH/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;/h10H,1-9H2;1H |
| InChIKey | GWOOEHDVLTWVQG-UHFFFAOYSA-N |
| Boiling point | 239.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 69.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Cyclohexylmorpholinium Chloride |