|
CAS#: 85118-21-4 Product: [2-Bromo-4-(trifluoromethyl)phenyl](4-fluorophenyl)methanol No suppilers available for the product. |
| Name | [2-Bromo-4-(trifluoromethyl)phenyl](4-fluorophenyl)methanol |
|---|---|
| Synonyms | 2-bromo-4'-fluoro-4-(trifluoromethyl)benzhydryl alcohol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9BrF4O |
| Molecular Weight | 349.12 |
| CAS Registry Number | 85118-21-4 |
| EINECS | 285-674-6 |
| SMILES | OC(c1ccc(cc1Br)C(F)(F)F)c2ccc(F)cc2 |
| InChI | 1S/C14H9BrF4O/c15-12-7-9(14(17,18)19)3-6-11(12)13(20)8-1-4-10(16)5-2-8/h1-7,13,20H |
| InChIKey | VZUYZKNNGRWOAF-UHFFFAOYSA-N |
| Density | 1.58g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.762°C at 760 mmHg (Cal.) |
| Flash point | 176.216°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [2-Bromo-4-(trifluoromethyl)phenyl](4-fluorophenyl)methanol |