|
CAS#: 85153-33-9 Product: Dipotassium 2-[(2-Ethylhexyl)Oxy]Ethyl Phosphate No suppilers available for the product. |
| Name | Dipotassium 2-[(2-Ethylhexyl)Oxy]Ethyl Phosphate |
|---|---|
| Synonyms | Dipotassium 2-((2-Ethylhexyl)Oxy)Ethyl Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H21K2O5P |
| Molecular Weight | 330.44 |
| CAS Registry Number | 85153-33-9 |
| EINECS | 285-813-0 |
| SMILES | C(O[P]([O-])([O-])=O)COCC(CCCC)CC.[K+].[K+] |
| InChI | 1S/C10H23O5P.2K/c1-3-5-6-10(4-2)9-14-7-8-15-16(11,12)13;;/h10H,3-9H2,1-2H3,(H2,11,12,13);;/q;2*+1/p-2 |
| InChIKey | ZRRJVXUFAHCWLV-UHFFFAOYSA-L |
| Boiling point | 372.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 178.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dipotassium 2-[(2-Ethylhexyl)Oxy]Ethyl Phosphate |