|
CAS#: 85153-48-6 Product: Tert-Butyl 2,4-Dichloro-3-Oxobutyrate No suppilers available for the product. |
| Name | Tert-Butyl 2,4-Dichloro-3-Oxobutyrate |
|---|---|
| Synonyms | Tert-Butyl 2,4-Dichloro-3-Oxo-Butanoate; 2,4-Dichloro-3-Oxobutanoic Acid Tert-Butyl Ester; 2,4-Dichloro-3-Keto-Butyric Acid Tert-Butyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12Cl2O3 |
| Molecular Weight | 227.09 |
| CAS Registry Number | 85153-48-6 |
| EINECS | 285-829-8 |
| SMILES | C(Cl)C(=O)C(Cl)C(OC(C)(C)C)=O |
| InChI | 1S/C8H12Cl2O3/c1-8(2,3)13-7(12)6(10)5(11)4-9/h6H,4H2,1-3H3 |
| InChIKey | UHHZHVDHAQZWES-UHFFFAOYSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 257.867°C at 760 mmHg (Cal.) |
| Flash point | 98.305°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tert-Butyl 2,4-Dichloro-3-Oxobutyrate |