|
CAS#: 85153-34-0 Product: Trimethyloctylammonium Dimethyl Phosphate No suppilers available for the product. |
| Name | Trimethyloctylammonium Dimethyl Phosphate |
|---|---|
| Synonyms | Dimethyl Phosphate; Trimethyl-Octyl-Ammonium; Dimethyl Phosphate; Trimethyl-Octylammonium; Dimethyl Phosphate; Trimethyl-Octyl-Azanium |
| Molecular Structure | ![]() |
| Molecular Formula | C13H32NO4P |
| Molecular Weight | 297.37 |
| CAS Registry Number | 85153-34-0 |
| EINECS | 285-814-6 |
| SMILES | CO[P](OC)([O-])=O.C([N+](C)(C)C)CCCCCCC |
| InChI | 1S/C11H26N.C2H7O4P/c1-5-6-7-8-9-10-11-12(2,3)4;1-5-7(3,4)6-2/h5-11H2,1-4H3;1-2H3,(H,3,4)/q+1;/p-1 |
| InChIKey | WCLHBKHYFYPXRV-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for Trimethyloctylammonium Dimethyl Phosphate |