|
CAS#: 85153-58-8 Product: N-(2,2-Dimethoxyethyl)Anilinium Chloride No suppilers available for the product. |
| Name | N-(2,2-Dimethoxyethyl)Anilinium Chloride |
|---|---|
| Synonyms | 2,2-Dimethoxyethyl-Phenyl-Ammonium Chloride; 2,2-Dimethoxyethyl-Phenylammonium Chloride; 2,2-Dimethoxyethyl-Phenyl-Azanium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16ClNO2 |
| Molecular Weight | 217.69 |
| CAS Registry Number | 85153-58-8 |
| EINECS | 285-840-8 |
| SMILES | C1=C([NH2+]CC(OC)OC)C=CC=C1.[Cl-] |
| InChI | 1S/C10H15NO2.ClH/c1-12-10(13-2)8-11-9-6-4-3-5-7-9;/h3-7,10-11H,8H2,1-2H3;1H |
| InChIKey | MKFGSELWXZSMGK-UHFFFAOYSA-N |
| Boiling point | 288.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 114.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,2-Dimethoxyethyl)Anilinium Chloride |