|
CAS#: 85153-66-8 Product: 1-Phenylethyl 2-Acetylacetoacetate No suppilers available for the product. |
| Name | 1-Phenylethyl 2-Acetylacetoacetate |
|---|---|
| Synonyms | 2-Acetyl-3-Keto-Butyric Acid 1-Phenylethyl Ester; 1-Phenylethyl 2-Acetyl-3-Oxo-Butanoate; 2-Acetyl-3-Oxobutanoic Acid 1-Phenylethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 |
| CAS Registry Number | 85153-66-8 |
| EINECS | 285-849-7 |
| SMILES | C1=CC=CC=C1C(OC(=O)C(C(=O)C)C(=O)C)C |
| InChI | 1S/C14H16O4/c1-9(15)13(10(2)16)14(17)18-11(3)12-7-5-4-6-8-12/h4-8,11,13H,1-3H3 |
| InChIKey | ZXBGGHFUQBYYGQ-UHFFFAOYSA-N |
| Density | 1.128g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.207°C at 760 mmHg (Cal.) |
| Flash point | 148.602°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenylethyl 2-Acetylacetoacetate |