Online Database of Chemicals from Around the World
|
CAS#: 85179-60-8 Product: 3-Carboxy-5-oxo-2-hexenedioic acid No suppilers available for the product. |
| Name | 3-Carboxy-5-oxo-2-hexenedioic acid |
|---|---|
| Synonyms | 4-Oxobut-1-Ene-1,2,4-Tricarboxylic Acid; (E)-4-Ketobut-1-Ene-1,2,4-Tricarboxylic Acid; 4-Ketobut-1-Ene-1,2,4-Tricarboxylic Acid |
| Molecular Structure |  |
| Molecular Formula | C7H6O7 |
| Molecular Weight | 202.12 |
| CAS Registry Number | 85179-60-8 |
| SMILES | C(\C(C(=O)O)=C/C(=O)O)C(=O)C(=O)O |
| InChI | 1S/C7H6O7/c8-4(7(13)14)1-3(6(11)12)2-5(9)10/h2H,1H2,(H,9,10)(H,11,12)(H,13,14)/b3-2+ |
| InChIKey | ODTDYYZJDQGKQT-NSCUHMNNSA-N |
| Density | 1.706g/cm3 (Cal.) |
|---|---|
| Boiling point | 523.878°C at 760 mmHg (Cal.) |
| Flash point | 284.711°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Carboxy-5-oxo-2-hexenedioic acid |