|
CAS#: 85201-34-9 Product: 3-Methoxy-17-methylmorphinan-4,6-diol No suppilers available for the product. |
| Name | 3-Methoxy-17-methylmorphinan-4,6-diol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 |
| CAS Registry Number | 85201-34-9 |
| EINECS | 286-227-8 |
| SMILES | OC3CC[C@H]4[C@H]2Cc1ccc(OC)c(O)c1[C@@]4(CCN2C)C3 |
| InChI | 1S/C18H25NO3/c1-19-8-7-18-10-12(20)4-5-13(18)14(19)9-11-3-6-15(22-2)17(21)16(11)18/h3,6,12-14,20-21H,4-5,7-10H2,1-2H3/t12?,13-,14+,18-/m0/s1 |
| InChIKey | SADZCZSUWMSOCW-HWSKEQOTSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.043°C at 760 mmHg (Cal.) |
| Flash point | 238.678°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxy-17-methylmorphinan-4,6-diol |