|
CAS#: 85262-94-8 Product: (2,4-Dichlorophenyl)Methyl Propanoate No suppilers available for the product. |
| Name | (2,4-Dichlorophenyl)Methyl Propanoate |
|---|---|
| Synonyms | Propanoic Acid (2,4-Dichlorophenyl)Methyl Ester; Propionic Acid (2,4-Dichlorobenzyl) Ester; Nsc404633 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09 |
| CAS Registry Number | 85262-94-8 |
| SMILES | C1=CC(=CC(=C1COC(=O)CC)Cl)Cl |
| InChI | 1S/C10H10Cl2O2/c1-2-10(13)14-6-7-3-4-8(11)5-9(7)12/h3-5H,2,6H2,1H3 |
| InChIKey | ABVWCZFYRJJFFG-UHFFFAOYSA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.084°C at 760 mmHg (Cal.) |
| Flash point | 113.654°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,4-Dichlorophenyl)Methyl Propanoate |