|
CAS#: 85305-20-0 Product: 2,4,6-Tris[1-(Methylphenyl)Ethyl]Phenol No suppilers available for the product. |
| Name | 2,4,6-Tris[1-(Methylphenyl)Ethyl]Phenol |
|---|---|
| Synonyms | 2,4,6-Tris(1-(Methylphenyl)Ethyl)Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C33H36O |
| Molecular Weight | 448.65 |
| CAS Registry Number | 85305-20-0 |
| EINECS | 286-658-1 |
| SMILES | C3=C(C(C1=CC=CC=C1C)C)C=C(C(C2=C(C=CC=C2)C)C)C(=C3C(C4=CC=CC=C4C)C)O |
| InChI | 1S/C33H36O/c1-21-13-7-10-16-28(21)24(4)27-19-31(25(5)29-17-11-8-14-22(29)2)33(34)32(20-27)26(6)30-18-12-9-15-23(30)3/h7-20,24-26,34H,1-6H3 |
| InChIKey | ZTULFNZHLNQJQG-UHFFFAOYSA-N |
| Density | 1.052g/cm3 (Cal.) |
|---|---|
| Boiling point | 561.641°C at 760 mmHg (Cal.) |
| Flash point | 255.403°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Tris[1-(Methylphenyl)Ethyl]Phenol |