|
CAS#: 85409-41-2 Product: Ethyl (2Z)-2-cyano-3-(6,6-dimethylbicyclo[3.1.1]hept-2-yl)acrylate No suppilers available for the product. |
| Name | Ethyl (2Z)-2-cyano-3-(6,6-dimethylbicyclo[3.1.1]hept-2-yl)acrylate |
|---|---|
| Synonyms | ethyl 2-c |
| Molecular Structure | ![]() |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.33 |
| CAS Registry Number | 85409-41-2 |
| EINECS | 287-109-9 |
| SMILES | CC2(C)C1CCC(\C=C(\C#N)C(=O)OCC)C2C1 |
| InChI | 1S/C15H21NO2/c1-4-18-14(17)11(9-16)7-10-5-6-12-8-13(10)15(12,2)3/h7,10,12-13H,4-6,8H2,1-3H3/b11-7- |
| InChIKey | AHMURUIVXKUDHR-XFFZJAGNSA-N |
| Density | 1.096g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.373°C at 760 mmHg (Cal.) |
| Flash point | 166.487°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2Z)-2-cyano-3-(6,6-dimethylbicyclo[3.1.1]hept-2-yl)acrylate |