|
CAS#: 85409-65-0 Product: 3,7,7-Trimethyl-3-(2-methyl-3-oxobutyl)bicyclo[4.1.0]heptan-2-one No suppilers available for the product. |
| Name | 3,7,7-Trimethyl-3-(2-methyl-3-oxobutyl)bicyclo[4.1.0]heptan-2-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 |
| CAS Registry Number | 85409-65-0 |
| EINECS | 287-136-6 |
| SMILES | CC2(C)C1C(=O)C(C)(CCC12)CC(C)C(C)=O |
| InChI | 1S/C15H24O2/c1-9(10(2)16)8-15(5)7-6-11-12(13(15)17)14(11,3)4/h9,11-12H,6-8H2,1-5H3 |
| InChIKey | JLDMXUUKIJKVPA-UHFFFAOYSA-N |
| Density | 0.972g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.296°C at 760 mmHg (Cal.) |
| Flash point | 119.57°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7,7-Trimethyl-3-(2-methyl-3-oxobutyl)bicyclo[4.1.0]heptan-2-one |