Online Database of Chemicals from Around the World
|
CAS#: 85423-02-5 Product: 2-[(4-Amino-3-Ethylphenyl)Methyl]-4-[(4-Aminophenyl)Methyl]Aniline No suppilers available for the product. |
| Name | 2-[(4-Amino-3-Ethylphenyl)Methyl]-4-[(4-Aminophenyl)Methyl]Aniline |
|---|---|
| Synonyms | 2-[(4-Amino-3-Ethyl-Phenyl)Methyl]-4-[(4-Aminophenyl)Methyl]Aniline; [4-(4-Aminobenzyl)-2-(4-Amino-3-Ethyl-Benzyl)Phenyl]Amine; 2-((4-Amino-3-Ethylphenyl)Methyl)-4-((4-Aminophenyl)Methyl)Aniline |
| Molecular Structure | ![CAS#: 85423-02-5, 2-[(4-Amino-3-Ethylphenyl)Methyl]-4-[(4-Aminophenyl)Methyl]Aniline](/moreStructures/85423-02-5.gif) |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.46 |
| CAS Registry Number | 85423-02-5 |
| EINECS | 287-205-0 |
| SMILES | C1=C(C=CC(=C1CC2=CC(=C(N)C=C2)CC)N)CC3=CC=C(N)C=C3 |
| InChI | 1S/C22H25N3/c1-2-18-12-17(6-9-21(18)24)14-19-13-16(5-10-22(19)25)11-15-3-7-20(23)8-4-15/h3-10,12-13H,2,11,14,23-25H2,1H3 |
| InChIKey | IWWLKYJVPXQUSG-UHFFFAOYSA-N |
| Density | 1.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 555.651°C at 760 mmHg (Cal.) |
| Flash point | 321.377°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Amino-3-Ethylphenyl)Methyl]-4-[(4-Aminophenyl)Methyl]Aniline |