|
CAS#: 85477-63-0 Product: 1,5-Dibromo-2,6-bis(bromomethyl)naphthalene No suppilers available for the product. |
| Name | 1,5-Dibromo-2,6-bis(bromomethyl)naphthalene |
|---|---|
| Synonyms | 1,5-Dibromo-2,6-bis(bromomethyl)naphthalene # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8Br4 |
| Molecular Weight | 471.81 |
| CAS Registry Number | 85477-63-0 |
| SMILES | BrCc1ccc2c(c1Br)ccc(c2Br)CBr |
| InChI | 1S/C12H8Br4/c13-5-7-1-3-9-10(11(7)15)4-2-8(6-14)12(9)16/h1-4H,5-6H2 |
| InChIKey | MLQVUBREAZVHCL-UHFFFAOYSA-N |
| Density | 2.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.47°C at 760 mmHg (Cal.) |
| Flash point | 229.15°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Dibromo-2,6-bis(bromomethyl)naphthalene |