|
CAS#: 855261-70-0 Product: 1H,1'H-4,4'-Biimidazole-5,5'-diol No suppilers available for the product. |
| Name | 1H,1'H-4,4'-Biimidazole-5,5'-diol |
|---|---|
| Synonyms | [4,4'-Bi-1H-imidazole]-5,5'-diol; 1H,1'H-4,4'-Biimidazol-5,5'-diol; 1H,1'H-4,4'-Biimidazole-5,5'-diol |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 |
| CAS Registry Number | 855261-70-0 |
| SMILES | c1[nH]c(c(n1)c2c([nH]cn2)O)O |
| InChI | 1S/C6H6N4O2/c11-5-3(7-1-9-5)4-6(12)10-2-8-4/h1-2,11-12H,(H,7,9)(H,8,10) |
| InChIKey | BDMVDRITVVCXFM-UHFFFAOYSA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 736.8±55.0°C at 760 mmHg (Cal.) |
| Flash point | 399.4±31.5°C (Cal.) |
| Refractive index | 1.778 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H,1'H-4,4'-Biimidazole-5,5'-diol |