|
CAS#: 85619-68-7 Product: 1-[17-(Cyclopropylmethyl)morphinan-3-yl]ethanone No suppilers available for the product. |
| Name | 1-[17-(Cyclopropylmethyl)morphinan-3-yl]ethanone |
|---|---|
| Synonyms | 1-(17-(Cyclopropylmethyl)morphinan-3-yl)ethanone; 3-Acetyl-N-(cyclpropylmethyl)morphinan; 3-Acpmm |
| Molecular Structure | ![]() |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.47 |
| CAS Registry Number | 85619-68-7 |
| SMILES | O=C(c1ccc4c(c1)[C@@]25[C@H]([C@H](N(CC2)CC3CC3)C4)CCCC5)C |
| InChI | 1S/C22H29NO/c1-15(24)17-7-8-18-13-21-19-4-2-3-9-22(19,20(18)12-17)10-11-23(21)14-16-5-6-16/h7-8,12,16,19,21H,2-6,9-11,13-14H2,1H3/t19-,21-,22-/m0/s1 |
| InChIKey | VSGPHNHYKRDWBH-BVSLBCMMSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.063°C at 760 mmHg (Cal.) |
| Flash point | 182.428°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[17-(Cyclopropylmethyl)morphinan-3-yl]ethanone |