|
CAS#: 85650-86-8 Product: 1,2-Di-sec-butyl-3,4-dimethylnaphthalene No suppilers available for the product. |
| Name | 1,2-Di-sec-butyl-3,4-dimethylnaphthalene |
|---|---|
| Synonyms | di-sec-butyldimethylnaphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 |
| CAS Registry Number | 85650-86-8 |
| EINECS | 288-096-2 |
| SMILES | CC(CC)c2c1ccccc1c(C)c(C)c2C(C)CC |
| InChI | 1S/C20H28/c1-7-13(3)19-16(6)15(5)17-11-9-10-12-18(17)20(19)14(4)8-2/h9-14H,7-8H2,1-6H3 |
| InChIKey | XSAHKZLTMQUPIO-UHFFFAOYSA-N |
| Density | 0.928g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.598°C at 760 mmHg (Cal.) |
| Flash point | 192.703°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Di-sec-butyl-3,4-dimethylnaphthalene |