|
CAS#: 85665-81-2 Product: 3,7-Dimethyl-1-(2-phenylethoxy)-1,7-octanediol No suppilers available for the product. |
| Name | 3,7-Dimethyl-1-(2-phenylethoxy)-1,7-octanediol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.43 |
| CAS Registry Number | 85665-81-2 |
| EINECS | 288-173-0 |
| SMILES | O(CCc1ccccc1)C(O)CC(C)CCCC(O)(C)C |
| InChI | 1S/C18H30O3/c1-15(8-7-12-18(2,3)20)14-17(19)21-13-11-16-9-5-4-6-10-16/h4-6,9-10,15,17,19-20H,7-8,11-14H2,1-3H3 |
| InChIKey | LWPLJHROTQIHMD-UHFFFAOYSA-N |
| Density | 1.017g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.755°C at 760 mmHg (Cal.) |
| Flash point | 190.727°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7-Dimethyl-1-(2-phenylethoxy)-1,7-octanediol |