|
CAS#: 85700-56-7 Product: (2S)-2,3-Dihydroxy-2-phenylpropanoic acid No suppilers available for the product. |
| Name | (2S)-2,3-Dihydroxy-2-phenylpropanoic acid |
|---|---|
| Synonyms | Anisodinic acid; Benzeneacetic acid, α-hydroxy-α-(hydroxymethyl)-, (S)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 |
| CAS Registry Number | 85700-56-7 |
| SMILES | O=C(O)[C@](O)(c1ccccc1)CO |
| InChI | 1S/C9H10O4/c10-6-9(13,8(11)12)7-4-2-1-3-5-7/h1-5,10,13H,6H2,(H,11,12)/t9-/m1/s1 |
| InChIKey | IWEPXSFVSUOTLW-SECBINFHSA-N |
| Density | 1.409g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.199°C at 760 mmHg (Cal.) |
| Flash point | 219.661°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2,3-Dihydroxy-2-phenylpropanoic acid |