|
CAS#: 85720-80-5 Product: 1,2-Dichloro-1,1,2-trifluoro-2-(pentafluoroethoxy)ethane No suppilers available for the product. |
| Name | 1,2-Dichloro-1,1,2-trifluoro-2-(pentafluoroethoxy)ethane |
|---|---|
| Synonyms | 1-(1,2-di |
| Molecular Structure | ![]() |
| Molecular Formula | C4Cl2F8O |
| Molecular Weight | 286.94 |
| CAS Registry Number | 85720-80-5 |
| EINECS | 288-386-9 |
| SMILES | FC(F)(OC(Cl)(F)C(F)(Cl)F)C(F)(F)F |
| InChI | 1S/C4Cl2F8O/c5-1(7,8)2(6,9)15-4(13,14)3(10,11)12 |
| InChIKey | BIDNOABTEVPBDS-UHFFFAOYSA-N |
| Density | 1.713g/cm3 (Cal.) |
|---|---|
| Boiling point | 99.186°C at 760 mmHg (Cal.) |
| Flash point | 13.788°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dichloro-1,1,2-trifluoro-2-(pentafluoroethoxy)ethane |