|
CAS#: 86451-38-9 Product: 5-{[(4-Chlorophenyl)sulfanyl]methyl}-2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridine No suppilers available for the product. |
| Name | 5-{[(4-Chlorophenyl)sulfanyl]methyl}-2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridine |
|---|---|
| Synonyms | 5-{[(4-ch |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18ClNO2S |
| Molecular Weight | 335.85 |
| CAS Registry Number | 86451-38-9 |
| SMILES | Clc3ccc(SCc1cnc(c2OC(OCc12)(C)C)C)cc3 |
| InChI | 1S/C17H18ClNO2S/c1-11-16-15(9-20-17(2,3)21-16)12(8-19-11)10-22-14-6-4-13(18)5-7-14/h4-8H,9-10H2,1-3H3 |
| InChIKey | QOQFIHNYLQDDPB-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.68°C at 760 mmHg (Cal.) |
| Flash point | 227.573°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-{[(4-Chlorophenyl)sulfanyl]methyl}-2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridine |