|
CAS#: 86475-37-8 Product: 2-Acetyl-4,4-dimethyl-1-phenyl-3-pyrazolidinone No suppilers available for the product. |
| Name | 2-Acetyl-4,4-dimethyl-1-phenyl-3-pyrazolidinone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 |
| CAS Registry Number | 86475-37-8 |
| EINECS | 289-240-7 |
| SMILES | O=C2N(C(=O)C)N(c1ccccc1)CC2(C)C |
| InChI | 1S/C13H16N2O2/c1-10(16)15-12(17)13(2,3)9-14(15)11-7-5-4-6-8-11/h4-8H,9H2,1-3H3 |
| InChIKey | XWKAZXKJYHZGAI-UHFFFAOYSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.674°C at 760 mmHg (Cal.) |
| Flash point | 130.334°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Acetyl-4,4-dimethyl-1-phenyl-3-pyrazolidinone |