|
CAS#: 864754-43-8 Product: N-(1-Dimethylamino-Ethylidene)-2-Ethyl-Thioisonicotinamide No suppilers available for the product. |
| Name | N-(1-Dimethylamino-Ethylidene)-2-Ethyl-Thioisonicotinamide |
|---|---|
| Synonyms | N-(1-Dimethylamino-Ethylidene)-2-Ethyl-Thioisonicotinamide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.35 |
| CAS Registry Number | 864754-43-8 |
| SMILES | C1=C(N=CC=C1C(=S)N=C(N(C)C)C)CC |
| InChI | 1S/C12H17N3S/c1-5-11-8-10(6-7-13-11)12(16)14-9(2)15(3)4/h6-8H,5H2,1-4H3 |
| InChIKey | ZEKZIKHHYNFSLL-UHFFFAOYSA-N |
| Density | 1.057g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.042°C at 760 mmHg (Cal.) |
| Flash point | 158.243°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(1-Dimethylamino-Ethylidene)-2-Ethyl-Thioisonicotinamide |