|
CAS#: 86596-79-4 Product: 3,3,6,6-Tetramethyl-2,3,6,7-tetrahydrothiepine 1,1-dioxide No suppilers available for the product. |
| Name | 3,3,6,6-Tetramethyl-2,3,6,7-tetrahydrothiepine 1,1-dioxide |
|---|---|
| Synonyms | Thiepin, 2,3,6,7-tetrahydro-3,3,6,6-tetramethyl-1,1-dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.31 |
| CAS Registry Number | 86596-79-4 |
| SMILES | O=S1(=O)CC(/C=C\C(C1)(C)C)(C)C |
| InChI | 1S/C10H18O2S/c1-9(2)5-6-10(3,4)8-13(11,12)7-9/h5-6H,7-8H2,1-4H3 |
| InChIKey | IECOJFJQIZQAFO-UHFFFAOYSA-N |
| Density | 1.007g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.518°C at 760 mmHg (Cal.) |
| Flash point | 152.721°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,6,6-Tetramethyl-2,3,6,7-tetrahydrothiepine 1,1-dioxide |