|
CAS#: 86626-71-3 Product: 2-[Ethyl(3-methylphenyl)amino]ethyl 4-(trichloromethyl)benzoate No suppilers available for the product. |
| Name | 2-[Ethyl(3-methylphenyl)amino]ethyl 4-(trichloromethyl)benzoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C19H20Cl3NO2 |
| Molecular Weight | 400.73 |
| CAS Registry Number | 86626-71-3 |
| EINECS | 289-261-1 |
| SMILES | ClC(Cl)(Cl)c1ccc(cc1)C(=O)OCCN(c2cc(ccc2)C)CC |
| InChI | 1S/C19H20Cl3NO2/c1-3-23(17-6-4-5-14(2)13-17)11-12-25-18(24)15-7-9-16(10-8-15)19(20,21)22/h4-10,13H,3,11-12H2,1-2H3 |
| InChIKey | AUUQESGZJHQNNE-UHFFFAOYSA-N |
| Density | 1.291g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.863°C at 760 mmHg (Cal.) |
| Flash point | 262.156°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[Ethyl(3-methylphenyl)amino]ethyl 4-(trichloromethyl)benzoate |