|
CAS#: 86708-78-3 Product: 5-Deoxy-1-O-phosphono-D-ribofuranose No suppilers available for the product. |
| Name | 5-Deoxy-1-O-phosphono-D-ribofuranose |
|---|---|
| Synonyms | 5-Deoxyribose 1-phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H11O7P |
| Molecular Weight | 214.11 |
| CAS Registry Number | 86708-78-3 |
| SMILES | O=P(OC1O[C@@H]([C@@H](O)[C@H]1O)C)(O)O |
| InChI | 1S/C5H11O7P/c1-2-3(6)4(7)5(11-2)12-13(8,9)10/h2-7H,1H3,(H2,8,9,10)/t2-,3-,4-,5?/m1/s1 |
| InChIKey | XXQFKXPJJNBLSU-SOOFDHNKSA-N |
| Density | 1.721g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.094°C at 760 mmHg (Cal.) |
| Flash point | 250.805°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Deoxy-1-O-phosphono-D-ribofuranose |