|
CAS#: 86799-45-3 Product: 3-Chloro-4-(dimethylamino)-2H-furo[2,3-h]chromen-2-one No suppilers available for the product. |
| Name | 3-Chloro-4-(dimethylamino)-2H-furo[2,3-h]chromen-2-one |
|---|---|
| Synonyms | Dma CA; N,N-Dimethyl-4-amino-3-chloroangelicin |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10ClNO3 |
| Molecular Weight | 263.68 |
| CAS Registry Number | 86799-45-3 |
| SMILES | Cl\C1=C(/N(C)C)c3c(OC1=O)c2ccoc2cc3 |
| InChI | 1S/C13H10ClNO3/c1-15(2)11-8-3-4-9-7(5-6-17-9)12(8)18-13(16)10(11)14/h3-6H,1-2H3 |
| InChIKey | RBTPBEOWYJTVTO-UHFFFAOYSA-N |
| Density | 1.437g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.925°C at 760 mmHg (Cal.) |
| Flash point | 192.039°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-4-(dimethylamino)-2H-furo[2,3-h]chromen-2-one |