|
CAS#: 86819-19-4 Product: 4-{[1-(Dimethylamino)-3-(2-{2-[4-(dimethylamino)phenyl]ethyl}phenoxy)-2-propanyl]oxy}-4-oxobutanoic acid dihydrochloride No suppilers available for the product. |
| Name | 4-{[1-(Dimethylamino)-3-(2-{2-[4-(dimethylamino)phenyl]ethyl}phenoxy)-2-propanyl]oxy}-4-oxobutanoic acid dihydrochloride |
|---|---|
| Synonyms | Butanedio |
| Molecular Structure | ![]() |
| Molecular Formula | C25H36Cl2N2O5 |
| Molecular Weight | 515.47 |
| CAS Registry Number | 86819-19-4 |
| SMILES | Cl.Cl.O=C(O)CCC(=O)OC(COc1ccccc1CCc2ccc(N(C)C)cc2)CN(C)C |
| InChI | 1S/C25H34N2O5.2ClH/c1-26(2)17-22(32-25(30)16-15-24(28)29)18-31-23-8-6-5-7-20(23)12-9-19-10-13-21(14-11-19)27(3)4;;/h5-8,10-11,13-14,22H,9,12,15-18H2,1-4H3,(H,28,29);2*1H |
| InChIKey | UOWCWVIUCLJTSU-UHFFFAOYSA-N |
| Boiling point | 602.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 318.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-{[1-(Dimethylamino)-3-(2-{2-[4-(dimethylamino)phenyl]ethyl}phenoxy)-2-propanyl]oxy}-4-oxobutanoic acid dihydrochloride |