|
CAS#: 86871-67-2 Product: 1-{3-[(5-Phenyl-1H-pyrazol-3-yl)oxy]propyl}piperidine ethanedioate (1:1) No suppilers available for the product. |
| Name | 1-{3-[(5-Phenyl-1H-pyrazol-3-yl)oxy]propyl}piperidine ethanedioate (1:1) |
|---|---|
| Synonyms | 1-(3-((5- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.42 |
| CAS Registry Number | 86871-67-2 |
| SMILES | O=C(O)C(=O)O.n2nc(c1ccccc1)cc2OCCCN3CCCCC3 |
| InChI | 1S/C17H23N3O.C2H2O4/c1-3-8-15(9-4-1)16-14-17(19-18-16)21-13-7-12-20-10-5-2-6-11-20;3-1(4)2(5)6/h1,3-4,8-9,14H,2,5-7,10-13H2,(H,18,19);(H,3,4)(H,5,6) |
| InChIKey | RSNWFMXVQBLRQY-UHFFFAOYSA-N |
| Boiling point | 495.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 253.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-{3-[(5-Phenyl-1H-pyrazol-3-yl)oxy]propyl}piperidine ethanedioate (1:1) |