|
CAS#: 874571-87-6 Product: 3-Cyclohexyl-2-phenyl-3H-thieno[2,3-d]imidazole-5-carboxylic acid No suppilers available for the product. |
| Name | 3-Cyclohexyl-2-phenyl-3H-thieno[2,3-d]imidazole-5-carboxylic acid |
|---|---|
| Synonyms | 3-cyclohe |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.41 |
| CAS Registry Number | 874571-87-6 |
| SMILES | C1CCC(CC1)N2C3=C(C=C(S3)C(=O)O)N=C2C4=CC=CC=C4 |
| InChI | 1S/C18H18N2O2S/c21-18(22)15-11-14-17(23-15)20(13-9-5-2-6-10-13)16(19-14)12-7-3-1-4-8-12/h1,3-4,7-8,11,13H,2,5-6,9-10H2,(H,21,22) |
| InChIKey | LQDFCZYHQVUFRD-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 568.7±53.0°C at 760 mmHg (Cal.) |
| Flash point | 297.7±30.9°C (Cal.) |
| Refractive index | 1.719 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Cyclohexyl-2-phenyl-3H-thieno[2,3-d]imidazole-5-carboxylic acid |