|
CAS#: 87548-97-8 Product: 4-Methyl-9H-thioxanthen-9-one No suppilers available for the product. |
| Name | 4-Methyl-9H-thioxanthen-9-one |
|---|---|
| Synonyms | 4-Methyl-thioxanthen-9-one |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10OS |
| Molecular Weight | 226.29 |
| CAS Registry Number | 87548-97-8 |
| EINECS | 289-321-7 |
| SMILES | CC1=C2C(=CC=C1)C(=O)C3=CC=CC=C3S2 |
| InChI | 1S/C14H10OS/c1-9-5-4-7-11-13(15)10-6-2-3-8-12(10)16-14(9)11/h2-8H,1H3 |
| InChIKey | IXBNDVAWTMCRPT-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.7±32.0°C at 760 mmHg (Cal.) |
| Flash point | 211.3±10.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-9H-thioxanthen-9-one |