Online Database of Chemicals from Around the World
|
CAS#: 885268-02-0 Product: 5-(Trifluoromethyl)-3,4-dihydro-1(2H)-naphthalenone No suppilers available for the product. |
| Name | 5-(Trifluoromethyl)-3,4-dihydro-1(2H)-naphthalenone |
|---|---|
| Synonyms | 1(2H)-Naphthalenone, 3,4-dihydro-5-(trifluoromethyl)-; 1(2H)-NAPHTHALENONE,3,4-DIHYDRO-5-(TRIFLUOROMETHYL)-; 5-(Trifluormethyl)-3,4-dihydro-1(2H)-naphthalinon |
| Molecular Structure |  |
| Molecular Formula | C11H9F3O |
| Molecular Weight | 214.18 |
| CAS Registry Number | 885268-02-0 |
| SMILES | c1cc2c(c(c1)C(F)(F)F)CCCC2=O |
| InChI | 1S/C11H9F3O/c12-11(13,14)9-5-1-4-8-7(9)3-2-6-10(8)15/h1,4-5H,2-3,6H2 |
| InChIKey | OHPGWVKTCNNPMH-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 257.6±40.0°C at 760 mmHg (Cal.) |
| Flash point | 113.0±18.8°C (Cal.) |
| Refractive index | 1.491 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(Trifluoromethyl)-3,4-dihydro-1(2H)-naphthalenone |