Online Database of Chemicals from Around the World
|
CAS#: 89705-56-6 Product: L-Tyrosylglycylglycyl-4-bromo-L-phenylalanyl-L-leucine No suppilers available for the product. |
| Name | L-Tyrosylglycylglycyl-4-bromo-L-phenylalanyl-L-leucine |
|---|---|
| Synonyms | 4-(4'-Bromo-phe)-leu-enkephalin; Enkephalin-leu, 4'-bromo-phe(4)- |
| Molecular Structure |  |
| Molecular Formula | C28H36BrN5O7 |
| Molecular Weight | 634.52 |
| CAS Registry Number | 89705-56-6 |
| SMILES | Brc1ccc(cc1)C[C@@H](C(=O)N[C@H](C(=O)O)CC(C)C)NC(=O)CNC(=O)CNC(=O)[C@@H](N)Cc2ccc(O)cc2 |
| InChI | 1S/C28H36BrN5O7/c1-16(2)11-23(28(40)41)34-27(39)22(13-18-3-7-19(29)8-4-18)33-25(37)15-31-24(36)14-32-26(38)21(30)12-17-5-9-20(35)10-6-17/h3-10,16,21-23,35H,11-15,30H2,1-2H3,(H,31,36)(H,32,38)(H,33,37)(H,34,39)(H,40,41)/t21-,22-,23-/m0/s1 |
| InChIKey | DVMJYBCIQUOGGA-VABKMULXSA-N |
| Density | 1.403g/cm3 (Cal.) |
|---|---|
| Boiling point | 1029.706°C at 760 mmHg (Cal.) |
| Flash point | 576.545°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Tyrosylglycylglycyl-4-bromo-L-phenylalanyl-L-leucine |