|
CAS#: 9011-07-8 Product: Acetic acid ethenyl ester polymer with 2,5-furandione No suppilers available for the product. |
| Name | Acetic acid ethenyl ester polymer with 2,5-furandione |
|---|---|
| Synonyms | Furan-2,5-Dione; Vinyl Acetate; Acetic Acid Vinyl Ester; Furan-2,5-Dione; Acetic Acid Vinyl Ester; Furan-2,5-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 184.15 |
| CAS Registry Number | 9011-07-8 |
| SMILES | O=C1OC(C=C1)=O.CC(OC=C)=O |
| InChI | 1S/C4H2O3.C4H6O2/c5-3-1-2-4(6)7-3;1-3-6-4(2)5/h1-2H;3H,1H2,2H3 |
| InChIKey | KRWWZDVIEFSIOT-UHFFFAOYSA-N |
| Boiling point | 202°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 103.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Acetic acid ethenyl ester polymer with 2,5-furandione |