Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 4-Nitrobenzoic anhydride |
|---|---|
| Synonyms | 4-Nitrobenzoic Acid [(4-Nitrophenyl)-Oxomethyl] Ester; 4-Nitrobenzoic Acid (4-Nitrobenzoyl) Ester; (4-Nitrophenyl)Carbonyl 4-Nitrobenzoate |
| Molecular Structure |  |
| Molecular Formula | C14H8N2O7 |
| Molecular Weight | 316.23 |
| CAS Registry Number | 902-47-6 |
| SMILES | C2=C(C(OC(=O)C1=CC=C([N+]([O-])=O)C=C1)=O)C=CC(=C2)[N+]([O-])=O |
| InChI | 1S/C14H8N2O7/c17-13(9-1-5-11(6-2-9)15(19)20)23-14(18)10-3-7-12(8-4-10)16(21)22/h1-8H |
| InChIKey | JYMVSZGJZRQOFY-UHFFFAOYSA-N |
| Density | 1.503g/cm3 (Cal.) |
|---|---|
| Boiling point | 542.297°C at 760 mmHg (Cal.) |
| Flash point | 251.301°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrobenzoic anhydride |