|
CAS#: 90467-12-2 Product: Dimethylphenyl-(tert-butyl)silane No suppilers available for the product. |
| Name | Dimethylphenyl-(tert-butyl)silane |
|---|---|
| Synonyms | Tert-Butyl-Dimethyl-Phenyl-Silane; Silane, Dimethyl-Phenyl-(Tert-Butyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20Si |
| Molecular Weight | 192.38 |
| CAS Registry Number | 90467-12-2 |
| SMILES | C1=C([Si](C(C)(C)C)(C)C)C=CC=C1 |
| InChI | 1S/C12H20Si/c1-12(2,3)13(4,5)11-9-7-6-8-10-11/h6-10H,1-5H3 |
| InChIKey | LHBSHRHABGHGRB-UHFFFAOYSA-N |
| Density | 0.856g/cm3 (Cal.) |
|---|---|
| Boiling point | 230.164°C at 760 mmHg (Cal.) |
| Flash point | 78.476°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethylphenyl-(tert-butyl)silane |