|
CAS#: 90468-14-7 Product: 3-Methylandrost-5-en-17-one No suppilers available for the product. |
| Name | 3-Methylandrost-5-en-17-one |
|---|---|
| Synonyms | Androst-5-En-17-One, 3-Methyl-, (3Beta)-; Ccris 3622; 3-Methylandrost-5-En-17-One |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 |
| CAS Registry Number | 90468-14-7 |
| SMILES | [C@@H]4(CC[C@]2(C(=CC[C@H]3[C@@H]1CCC([C@@]1(C)CC[C@H]23)=O)C4)C)C |
| InChI | 1S/C20H30O/c1-13-8-10-19(2)14(12-13)4-5-15-16-6-7-18(21)20(16,3)11-9-17(15)19/h4,13,15-17H,5-12H2,1-3H3/t13-,15-,16-,17-,19-,20-/m0/s1 |
| InChIKey | PDSLFUNQCAQCJE-SWEGMTMGSA-N |
| Density | 1.039g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.396°C at 760 mmHg (Cal.) |
| Flash point | 166.63°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methylandrost-5-en-17-one |