Online Database of Chemicals from Around the World
|
CAS#: 90500-72-4 Product: 6-Chloro-2-pyridylmethyl nitrate No suppilers available for the product. |
| Name | 6-Chloro-2-pyridylmethyl nitrate |
|---|---|
| Synonyms | (6-Chloro-2-Pyridyl)Methyl Nitrate; Nitric Acid (6-Chloro-2-Pyridyl)Methyl Ester; 2-Pyridinemethanol, 6-Chloro-, Nitrate (Ester) |
| Molecular Structure |  |
| Molecular Formula | C6H5ClN2O3 |
| Molecular Weight | 188.57 |
| CAS Registry Number | 90500-72-4 |
| SMILES | C1=C(N=C(Cl)C=C1)CO[N+]([O-])=O |
| InChI | 1S/C6H5ClN2O3/c7-6-3-1-2-5(8-6)4-12-9(10)11/h1-3H,4H2 |
| InChIKey | KLKMRHCMLLGCSZ-UHFFFAOYSA-N |
| Density | 1.45g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.825°C at 760 mmHg (Cal.) |
| Flash point | 128.477°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-2-pyridylmethyl nitrate |