|
CAS#: 90605-14-4 Product: Sodium isobutyl hydrogen phosphate No suppilers available for the product. |
| Name | Sodium isobutyl hydrogen phosphate |
|---|---|
| Synonyms | Phosphoric acid, 2-methylpropyl ester, sodium salt |
| Molecular Structure | ![]() |
| Molecular Formula | C4H10NaO4P |
| Molecular Weight | 176.08 |
| CAS Registry Number | 90605-14-4 |
| EINECS | 292-412-4 |
| SMILES | [Na+].CC(C)COP([O-])(O)=O |
| InChI | 1S/C4H11O4P.Na/c1-4(2)3-8-9(5,6)7;/h4H,3H2,1-2H3,(H2,5,6,7);/q;+1/p-1 |
| InChIKey | PVLJSWJOIKFTRS-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for Sodium isobutyl hydrogen phosphate |