|
CAS#: 90899-85-7 Product: N-Carbamyl-l-tyrosine No suppilers available for the product. |
| Name | N-Carbamyl-l-tyrosine |
|---|---|
| Synonyms | (2S)-3-(4-Hydroxyphenyl)-2-Ureido-Propanoic Acid; (2S)-3-(4-Hydroxyphenyl)-2-Ureidopropanoic Acid; (2S)-3-(4-Hydroxyphenyl)-2-Ureido-Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 |
| CAS Registry Number | 90899-85-7 |
| SMILES | [C@H](NC(=O)N)(CC1=CC=C(O)C=C1)C(=O)O |
| InChI | 1S/C10H12N2O4/c11-10(16)12-8(9(14)15)5-6-1-3-7(13)4-2-6/h1-4,8,13H,5H2,(H,14,15)(H3,11,12,16)/t8-/m0/s1 |
| InChIKey | PNLKYZVGQWCHBH-QMMMGPOBSA-N |
| Density | 1.416g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.407°C at 760 mmHg (Cal.) |
| Flash point | 244.946°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Carbamyl-l-tyrosine |