|
CAS#: 909666-43-9 Product: 1-[2-Chloro-4-methyl-5-(methylsulfonyl)phenyl]-4-{[6-(trifluoromethyl)-3-pyridinyl]methyl}piperazine No suppilers available for the product. |
| Name | 1-[2-Chloro-4-methyl-5-(methylsulfonyl)phenyl]-4-{[6-(trifluoromethyl)-3-pyridinyl]methyl}piperazine |
|---|---|
| Synonyms | 1-[2-chlo |
| Molecular Structure | ![]() |
| Molecular Formula | C19H21ClF3N3O2S |
| Molecular Weight | 447.90 |
| CAS Registry Number | 909666-43-9 |
| SMILES | CS(=O)(=O)c3cc(N2CCN(Cc1cnc(cc1)C(F)(F)F)CC2)c(Cl)cc3C |
| InChI | 1S/C19H21ClF3N3O2S/c1-13-9-15(20)16(10-17(13)29(2,27)28)26-7-5-25(6-8-26)12-14-3-4-18(24-11-14)19(21,22)23/h3-4,9-11H,5-8,12H2,1-2H3 |
| InChIKey | JBRVUPJXHRBGGN-UHFFFAOYSA-N |
| Density | 1.366g/cm3 (Cal.) |
|---|---|
| Boiling point | 582.736°C at 760 mmHg (Cal.) |
| Flash point | 306.228°C (Cal.) |
| Refractive index | 1.56 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[2-Chloro-4-methyl-5-(methylsulfonyl)phenyl]-4-{[6-(trifluoromethyl)-3-pyridinyl]methyl}piperazine |