|
CAS#: 909666-49-5 Product: 1-[4-Chloro-2-(methylsulfonyl)phenyl]-4-{[6-(trifluoromethyl)-3-pyridinyl]methyl}piperazine No suppilers available for the product. |
| Name | 1-[4-Chloro-2-(methylsulfonyl)phenyl]-4-{[6-(trifluoromethyl)-3-pyridinyl]methyl}piperazine |
|---|---|
| Synonyms | 1-[4-chlo |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19ClF3N3O2S |
| Molecular Weight | 433.88 |
| CAS Registry Number | 909666-49-5 |
| SMILES | CS(=O)(=O)c3cc(Cl)ccc3N2CCN(Cc1cnc(cc1)C(F)(F)F)CC2 |
| InChI | 1S/C18H19ClF3N3O2S/c1-28(26,27)16-10-14(19)3-4-15(16)25-8-6-24(7-9-25)12-13-2-5-17(23-11-13)18(20,21)22/h2-5,10-11H,6-9,12H2,1H3 |
| InChIKey | YNCITXCJSKFYIM-UHFFFAOYSA-N |
| Density | 1.393g/cm3 (Cal.) |
|---|---|
| Boiling point | 564.621°C at 760 mmHg (Cal.) |
| Flash point | 295.272°C (Cal.) |
| Refractive index | 1.564 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[4-Chloro-2-(methylsulfonyl)phenyl]-4-{[6-(trifluoromethyl)-3-pyridinyl]methyl}piperazine |