|
CAS#: 909666-68-8 Product: 1H-Indol-6-yl(4-{[6-(trifluoromethyl)-3-pyridinyl]methyl}-1-piperazinyl)methanone No suppilers available for the product. |
| Name | 1H-Indol-6-yl(4-{[6-(trifluoromethyl)-3-pyridinyl]methyl}-1-piperazinyl)methanone |
|---|---|
| Synonyms | 6-[(4-{[6 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H19F3N4O |
| Molecular Weight | 388.39 |
| CAS Registry Number | 909666-68-8 |
| SMILES | FC(F)(F)c1ccc(cn1)CN2CCN(CC2)C(=O)c3ccc4ccnc4c3 |
| InChI | 1S/C20H19F3N4O/c21-20(22,23)18-4-1-14(12-25-18)13-26-7-9-27(10-8-26)19(28)16-3-2-15-5-6-24-17(15)11-16/h1-6,11-12,24H,7-10,13H2 |
| InChIKey | UTSUKWLFSFOVMB-UHFFFAOYSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 544.51°C at 760 mmHg (Cal.) |
| Flash point | 283.11°C (Cal.) |
| Refractive index | 1.622 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Indol-6-yl(4-{[6-(trifluoromethyl)-3-pyridinyl]methyl}-1-piperazinyl)methanone |