|
CAS#: 91038-03-8 Product: N-Ethyldiazenyl-4-Nitro-Aniline No suppilers available for the product. |
| Name | N-Ethyldiazenyl-4-Nitro-Aniline |
|---|---|
| Synonyms | N-Ethylazo-4-Nitro-Aniline; N-Ethylazo-4-Nitroaniline; Ethylazo-(4-Nitrophenyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 |
| CAS Registry Number | 91038-03-8 |
| SMILES | C1=C(NN=NCC)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C8H10N4O2/c1-2-9-11-10-7-3-5-8(6-4-7)12(13)14/h3-6H,2H2,1H3,(H,9,10) |
| InChIKey | RYRYCGWJMVYUNP-UHFFFAOYSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.857°C at 760 mmHg (Cal.) |
| Flash point | 138.778°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyldiazenyl-4-Nitro-Aniline |