|
CAS#: 91147-54-5 Product: 2-Hydroxypropylvaline No suppilers available for the product. |
| Name | 2-Hydroxypropylvaline |
|---|---|
| Synonyms | (2S)-2-(2-Hydroxypropylamino)-3-Methyl-Butanoic Acid; (2S)-2-(2-Hydroxypropylamino)-3-Methyl-Butyric Acid; 2-Hydroxypropylvaline |
| Molecular Structure | ![]() |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 |
| CAS Registry Number | 91147-54-5 |
| SMILES | [C@H](C(=O)O)(NCC(C)O)C(C)C |
| InChI | 1S/C8H17NO3/c1-5(2)7(8(11)12)9-4-6(3)10/h5-7,9-10H,4H2,1-3H3,(H,11,12)/t6?,7-/m0/s1 |
| InChIKey | LQFKABMWUHITQU-MLWJPKLSSA-N |
| Density | 1.077g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.07°C at 760 mmHg (Cal.) |
| Flash point | 152.211°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxypropylvaline |