|
CAS#: 91575-28-9 Product: N-Acetyl-4,4'-Methylenebis(2-Chloroaniline) No suppilers available for the product. |
| Name | N-Acetyl-4,4'-Methylenebis(2-Chloroaniline) |
|---|---|
| Synonyms | N-[4-[(4-Amino-3-Chloro-Phenyl)Methyl]-2-Chloro-Phenyl]Acetamide; N-[4-(4-Amino-3-Chloro-Benzyl)-2-Chloro-Phenyl]Acetamide; N-[4-[(4-Amino-3-Chloro-Phenyl)Methyl]-2-Chloro-Phenyl]Ethanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14Cl2N2O |
| Molecular Weight | 309.19 |
| CAS Registry Number | 91575-28-9 |
| SMILES | C2=C(CC1=CC(=C(N)C=C1)Cl)C=CC(=C2Cl)NC(=O)C |
| InChI | 1S/C15H14Cl2N2O/c1-9(20)19-15-5-3-11(8-13(15)17)6-10-2-4-14(18)12(16)7-10/h2-5,7-8H,6,18H2,1H3,(H,19,20) |
| InChIKey | JCHPXNSTFVJJLN-UHFFFAOYSA-N |
| Density | 1.356g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.821°C at 760 mmHg (Cal.) |
| Flash point | 257.292°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-4,4'-Methylenebis(2-Chloroaniline) |